About (3S)-3-(3,5-dioxopiperazin-1-yl)butanoic acid
(3S)-3-(3,5-dioxopiperazin-1-yl)butanoic acid (PubChem CID 59840651) has the molecular formula C8H12N2O4
and a molecular weight of 200.19 g/mol. Its IUPAC name is (3S)-3-(3,5-dioxopiperazin-1-yl)butanoic acid.
Molecular Properties
| Compound Name | (3S)-3-(3,5-dioxopiperazin-1-yl)butanoic acid |
| PubChem CID | 59840651 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | (3S)-3-(3,5-dioxopiperazin-1-yl)butanoic acid |
| SMILES | C[C@@H](CC(=O)O)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C8H12N2O4/c1-5(2-8(13)14)10-3-6(11)9-7(12)4-10/h5H,2-4H2,1H3,(H,13,14)(H,9,11,12)/t5-/m0/s1 |
| InChIKey | BGMHTGVZTKPMGV-YFKPBYRVSA-N |
| XLogP | -1.19 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-(3,5-dioxopiperazin-1-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(3,5-dioxopiperazin-1-yl)butanoic acid?
The IUPAC name of (3S)-3-(3,5-dioxopiperazin-1-yl)butanoic acid (CID 59840651) is (3S)-3-(3,5-dioxopiperazin-1-yl)butanoic acid.
What is the SMILES notation for (3S)-3-(3,5-dioxopiperazin-1-yl)butanoic acid?
The canonical SMILES for (3S)-3-(3,5-dioxopiperazin-1-yl)butanoic acid is C[C@@H](CC(=O)O)N1CC(=O)NC(=O)C1.
What is the InChIKey of (3S)-3-(3,5-dioxopiperazin-1-yl)butanoic acid?
The InChIKey is BGMHTGVZTKPMGV-YFKPBYRVSA-N. The full InChI is InChI=1S/C8H12N2O4/c1-5(2-8(13)14)10-3-6(11)9-7(12)4-10/h5H,2-4H2,1H3,(H,13,14)(H,9,11,12)/t5-/m0/s1.
What are the key properties of (3S)-3-(3,5-dioxopiperazin-1-yl)butanoic acid?
(3S)-3-(3,5-dioxopiperazin-1-yl)butanoic acid has a molecular weight of 200.19 g/mol, XLogP of -1.19, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(3,5-dioxopiperazin-1-yl)butanoic acid is sourced from PubChem (CID 59840651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).