C40H72O7Si — CID 59840853
[(4E)-10-[diethyl(propan-2-yl)silyl]oxy-2-[(2E,4E)-8,11-dihydroxy-6,6,9,10-tetramethyltrideca-2,4-dien-2-yl]-3,7,7-trimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 59840853) has the molecular formula C40H72O7Si and a molecular weight of 693.10 g/mol. Its IUPAC name is [(4E)-10-[diethyl(propan-2-yl)silyl]oxy-2-[(2E,4E)-8,11-dihydroxy-6,6,9,10-tetramethyltrideca-2,4-dien-2-yl]-3,7,7-trimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(4E)-10-[diethyl(propan-2-yl)silyl]oxy-2-[(2E,4E)-8,11-dihydroxy-6,6,9,10-tetramethyltrideca-2,4-dien-2-yl]-3,7,7-trimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 59840853 |
| Molecular Formula | C40H72O7Si |
| Molecular Weight | 693.10 g/mol |
| Exact Mass | 692.50 |
| IUPAC Name | [(4E)-10-[diethyl(propan-2-yl)silyl]oxy-2-[(2E,4E)-8,11-dihydroxy-6,6,9,10-tetramethyltrideca-2,4-dien-2-yl]-3,7,7-trimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CCC(O)C(C)C(C)C(O)CC(C)(C)/C=C/C=C(\C)C1OC(=O)CC(O[Si](CC)(CC)C(C)C)CCC(C)(C)C(OC(C)=O)/C=C/C1C |
| InChI | InChI=1S/C40H72O7Si/c1-15-34(42)30(8)31(9)35(43)26-39(11,12)23-18-19-28(6)38-29(7)20-21-36(45-32(10)41)40(13,14)24-22-33(25-37(44)46-38)47-48(16-2,17-3)27(4)5/h18-21,23,27,29-31,33-36,38,42-43H,15-17,22,24-26H2,1-14H3/b21-20+,23-18+,28-19+ |
| InChIKey | NRPHQXHROBJFDV-HHGHZHAVSA-N |
| XLogP | 9.34 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.10 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|