C33H56O7 — CID 59840857
[(4E)-2-[(2E,4E)-6,8-dihydroxy-6,9,10,11-tetramethyltrideca-2,4-dien-2-yl]-7-hydroxy-3,7,10-trimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 59840857) has the molecular formula C33H56O7 and a molecular weight of 564.80 g/mol. Its IUPAC name is [(4E)-2-[(2E,4E)-6,8-dihydroxy-6,9,10,11-tetramethyltrideca-2,4-dien-2-yl]-7-hydroxy-3,7,10-trimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(4E)-2-[(2E,4E)-6,8-dihydroxy-6,9,10,11-tetramethyltrideca-2,4-dien-2-yl]-7-hydroxy-3,7,10-trimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 59840857 |
| Molecular Formula | C33H56O7 |
| Molecular Weight | 564.80 g/mol |
| Exact Mass | 564.40 |
| IUPAC Name | [(4E)-2-[(2E,4E)-6,8-dihydroxy-6,9,10,11-tetramethyltrideca-2,4-dien-2-yl]-7-hydroxy-3,7,10-trimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CCC(C)C(C)C(C)C(O)CC(C)(O)/C=C/C=C(\C)C1OC(=O)CC(C)CCC(C)(O)C(OC(C)=O)/C=C/C1C |
| InChI | InChI=1S/C33H56O7/c1-11-22(3)25(6)26(7)28(35)20-32(9,37)17-12-13-23(4)31-24(5)14-15-29(39-27(8)34)33(10,38)18-16-21(2)19-30(36)40-31/h12-15,17,21-22,24-26,28-29,31,35,37-38H,11,16,18-20H2,1-10H3/b15-14+,17-12+,23-13+ |
| InChIKey | NHTSZONCJHPCLV-WEQOJROLSA-N |
| XLogP | 5.92 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.80 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|