C16H29FN2O3 — CID 59841326
butyl N-[[5-(carbonofluoridoylamino)-1,3,3-trimethylcyclohexyl]methyl]carbamate (PubChem CID 59841326) has the molecular formula C16H29FN2O3 and a molecular weight of 316.42 g/mol. Its IUPAC name is butyl N-[[5-(carbonofluoridoylamino)-1,3,3-trimethylcyclohexyl]methyl]carbamate.
| Compound Name | butyl N-[[5-(carbonofluoridoylamino)-1,3,3-trimethylcyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 59841326 |
| Molecular Formula | C16H29FN2O3 |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | butyl N-[[5-(carbonofluoridoylamino)-1,3,3-trimethylcyclohexyl]methyl]carbamate |
| SMILES | CCCCOC(=O)NCC1(C)CC(NC(=O)F)CC(C)(C)C1 |
| InChI | InChI=1S/C16H29FN2O3/c1-5-6-7-22-14(21)18-11-16(4)9-12(19-13(17)20)8-15(2,3)10-16/h12H,5-11H2,1-4H3,(H,18,21)(H,19,20) |
| InChIKey | JQCKETBNIDDZFQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|