C19H34N2O10 — CID 59841381
methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(2R,4S,5R)-3,4,5-trihydroxy-6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]oxan-2-yl]acetate (PubChem CID 59841381) has the molecular formula C19H34N2O10 and a molecular weight of 450.49 g/mol. Its IUPAC name is methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(2R,4S,5R)-3,4,5-trihydroxy-6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]oxan-2-yl]acetate.
| Compound Name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(2R,4S,5R)-3,4,5-trihydroxy-6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]oxan-2-yl]acetate |
|---|---|
| PubChem CID | 59841381 |
| Molecular Formula | C19H34N2O10 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(2R,4S,5R)-3,4,5-trihydroxy-6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]oxan-2-yl]acetate |
| SMILES | COC(=O)[C@H](NC(=O)OC(C)(C)C)[C@H]1OC(CNC(=O)OC(C)(C)C)[C@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C19H34N2O10/c1-18(2,3)30-16(26)20-8-9-11(22)12(23)13(24)14(29-9)10(15(25)28-7)21-17(27)31-19(4,5)6/h9-14,22-24H,8H2,1-7H3,(H,20,26)(H,21,27)/t9?,10-,11+,12+,13?,14-/m1/s1 |
| InChIKey | KMNNUWCKTNZFQS-CSEAEOGESA-N |
| XLogP | -0.57 |
| TPSA | 172.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|