C28H44N2O6 — CID 59841597
[(1S,2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(4-aminocyclohexyl)oxycarbonylcarbamate (PubChem CID 59841597) has the molecular formula C28H44N2O6 and a molecular weight of 504.67 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(4-aminocyclohexyl)oxycarbonylcarbamate.
| Compound Name | [(1S,2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(4-aminocyclohexyl)oxycarbonylcarbamate |
|---|---|
| PubChem CID | 59841597 |
| Molecular Formula | C28H44N2O6 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(4-aminocyclohexyl)oxycarbonylcarbamate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)NC(=O)OC2CCC(N)CC2)[C@]2(C)C(C)CC[C@]3(CCC(=O)C32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C28H44N2O6/c1-6-26(4)15-21(36-25(34)30-24(33)35-19-9-7-18(29)8-10-19)27(5)16(2)11-13-28(17(3)23(26)32)14-12-20(31)22(27)28/h6,16-19,21-23,32H,1,7-15,29H2,2-5H3,(H,30,33,34)/t16?,17-,18?,19?,21+,22?,23-,26+,27-,28-/m0/s1 |
| InChIKey | QVHFTZSOECOAJY-QFNNKRMISA-N |
| XLogP | 4.48 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|