C23H35NO6 — CID 59841601
methyl N-[[(1S,2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxycarbonyl]carbamate (PubChem CID 59841601) has the molecular formula C23H35NO6 and a molecular weight of 421.53 g/mol. Its IUPAC name is methyl N-[[(1S,2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxycarbonyl]carbamate.
| Compound Name | methyl N-[[(1S,2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 59841601 |
| Molecular Formula | C23H35NO6 |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | methyl N-[[(1S,2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxycarbonyl]carbamate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)NC(=O)OC)[C@]2(C)C(C)CC[C@]3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C23H35NO6/c1-7-21(4)12-16(30-20(28)24-19(27)29-6)22(5)13(2)8-10-23(14(3)18(21)26)11-9-15(25)17(22)23/h7,13-14,16-18,26H,1,8-12H2,2-6H3,(H,24,27,28)/t13?,14-,16+,17-,18-,21+,22-,23-/m0/s1 |
| InChIKey | KFYOROIURUIQID-SMPCVTMASA-N |
| XLogP | 3.84 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|