About (Z)-11-(2-methyl-1,3-dioxolan-2-yl)undec-5-enal
(Z)-11-(2-methyl-1,3-dioxolan-2-yl)undec-5-enal (PubChem CID 59841782) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is (Z)-11-(2-methyl-1,3-dioxolan-2-yl)undec-5-enal.
Molecular Properties
| Compound Name | (Z)-11-(2-methyl-1,3-dioxolan-2-yl)undec-5-enal |
| PubChem CID | 59841782 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (Z)-11-(2-methyl-1,3-dioxolan-2-yl)undec-5-enal |
| SMILES | CC1(CCCCC/C=C\CCCC=O)OCCO1 |
| InChI | InChI=1S/C15H26O3/c1-15(17-13-14-18-15)11-9-7-5-3-2-4-6-8-10-12-16/h2,4,12H,3,5-11,13-14H2,1H3/b4-2- |
| InChIKey | JVHRVHFVYMZXSR-RQOWECAXSA-N |
| XLogP | 3.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-11-(2-methyl-1,3-dioxolan-2-yl)undec-5-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-11-(2-methyl-1,3-dioxolan-2-yl)undec-5-enal?
The IUPAC name of (Z)-11-(2-methyl-1,3-dioxolan-2-yl)undec-5-enal (CID 59841782) is (Z)-11-(2-methyl-1,3-dioxolan-2-yl)undec-5-enal.
What is the SMILES notation for (Z)-11-(2-methyl-1,3-dioxolan-2-yl)undec-5-enal?
The canonical SMILES for (Z)-11-(2-methyl-1,3-dioxolan-2-yl)undec-5-enal is CC1(CCCCC/C=C\CCCC=O)OCCO1.
What is the InChIKey of (Z)-11-(2-methyl-1,3-dioxolan-2-yl)undec-5-enal?
The InChIKey is JVHRVHFVYMZXSR-RQOWECAXSA-N. The full InChI is InChI=1S/C15H26O3/c1-15(17-13-14-18-15)11-9-7-5-3-2-4-6-8-10-12-16/h2,4,12H,3,5-11,13-14H2,1H3/b4-2-.
What are the key properties of (Z)-11-(2-methyl-1,3-dioxolan-2-yl)undec-5-enal?
(Z)-11-(2-methyl-1,3-dioxolan-2-yl)undec-5-enal has a molecular weight of 254.37 g/mol, XLogP of 3.63, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-11-(2-methyl-1,3-dioxolan-2-yl)undec-5-enal is sourced from PubChem (CID 59841782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).