About 5,6-bis(azanidylidene)-4-methylcyclohexa-1,3-diene-1-sulfonate;yttrium
5,6-bis(azanidylidene)-4-methylcyclohexa-1,3-diene-1-sulfonate;yttrium (PubChem CID 59842010) has the molecular formula C7H5N2O3SY-3
and a molecular weight of 286.10 g/mol. Its IUPAC name is 5,6-bis(azanidylidene)-4-methylcyclohexa-1,3-diene-1-sulfonate;yttrium.
Molecular Properties
| Compound Name | 5,6-bis(azanidylidene)-4-methylcyclohexa-1,3-diene-1-sulfonate;yttrium |
| PubChem CID | 59842010 |
| Molecular Formula | C7H5N2O3SY-3 |
| Molecular Weight | 286.10 g/mol |
| Exact Mass | 285.91 |
| IUPAC Name | 5,6-bis(azanidylidene)-4-methylcyclohexa-1,3-diene-1-sulfonate;yttrium |
| SMILES | CC1=CC=C(S(=O)(=O)[O-])C(=[N-])C1=[N-].[Y] |
| InChI | InChI=1S/C7H6N2O3S.Y/c1-4-2-3-5(13(10,11)12)7(9)6(4)8;/h2-3H,1H3,(H,10,11,12);/q-2;/p-1 |
| InChIKey | KIOXXJBMEAWDLE-UHFFFAOYSA-M |
| XLogP | 0.39 |
| TPSA | 101.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.10 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5,6-bis(azanidylidene)-4-methylcyclohexa-1,3-diene-1-sulfonate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-bis(azanidylidene)-4-methylcyclohexa-1,3-diene-1-sulfonate;yttrium?
The IUPAC name of 5,6-bis(azanidylidene)-4-methylcyclohexa-1,3-diene-1-sulfonate;yttrium (CID 59842010) is 5,6-bis(azanidylidene)-4-methylcyclohexa-1,3-diene-1-sulfonate;yttrium.
What is the SMILES notation for 5,6-bis(azanidylidene)-4-methylcyclohexa-1,3-diene-1-sulfonate;yttrium?
The canonical SMILES for 5,6-bis(azanidylidene)-4-methylcyclohexa-1,3-diene-1-sulfonate;yttrium is CC1=CC=C(S(=O)(=O)[O-])C(=[N-])C1=[N-].[Y].
What is the InChIKey of 5,6-bis(azanidylidene)-4-methylcyclohexa-1,3-diene-1-sulfonate;yttrium?
The InChIKey is KIOXXJBMEAWDLE-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6N2O3S.Y/c1-4-2-3-5(13(10,11)12)7(9)6(4)8;/h2-3H,1H3,(H,10,11,12);/q-2;/p-1.
What are the key properties of 5,6-bis(azanidylidene)-4-methylcyclohexa-1,3-diene-1-sulfonate;yttrium?
5,6-bis(azanidylidene)-4-methylcyclohexa-1,3-diene-1-sulfonate;yttrium has a molecular weight of 286.10 g/mol, XLogP of 0.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-bis(azanidylidene)-4-methylcyclohexa-1,3-diene-1-sulfonate;yttrium is sourced from PubChem (CID 59842010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).