C18H28F2 — CID 59842323
(8aR)-6-(difluoromethylidene)-8a-methyl-1,2-di(propan-2-yl)-1,2,3,5,7,8-hexahydronaphthalene (PubChem CID 59842323) has the molecular formula C18H28F2 and a molecular weight of 282.42 g/mol. Its IUPAC name is (8aR)-6-(difluoromethylidene)-8a-methyl-1,2-di(propan-2-yl)-1,2,3,5,7,8-hexahydronaphthalene.
| Compound Name | (8aR)-6-(difluoromethylidene)-8a-methyl-1,2-di(propan-2-yl)-1,2,3,5,7,8-hexahydronaphthalene |
|---|---|
| PubChem CID | 59842323 |
| Molecular Formula | C18H28F2 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (8aR)-6-(difluoromethylidene)-8a-methyl-1,2-di(propan-2-yl)-1,2,3,5,7,8-hexahydronaphthalene |
| SMILES | CC(C)C1CC=C2CC(=C(F)F)CC[C@]2(C)C1C(C)C |
| InChI | InChI=1S/C18H28F2/c1-11(2)15-7-6-14-10-13(17(19)20)8-9-18(14,5)16(15)12(3)4/h6,11-12,15-16H,7-10H2,1-5H3/t15?,16?,18-/m0/s1 |
| InChIKey | BMKCFYFWJOOGOT-HTWSVDAQSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|