C17H26F2 — CID 59842330
(8aR)-6,6-difluoro-8a-methyl-1,2-di(propan-2-yl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 59842330) has the molecular formula C17H26F2 and a molecular weight of 268.39 g/mol. Its IUPAC name is (8aR)-6,6-difluoro-8a-methyl-1,2-di(propan-2-yl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (8aR)-6,6-difluoro-8a-methyl-1,2-di(propan-2-yl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 59842330 |
| Molecular Formula | C17H26F2 |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (8aR)-6,6-difluoro-8a-methyl-1,2-di(propan-2-yl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC(C)C1CCC2=CC(F)(F)C=C[C@]2(C)C1C(C)C |
| InChI | InChI=1S/C17H26F2/c1-11(2)14-7-6-13-10-17(18,19)9-8-16(13,5)15(14)12(3)4/h8-12,14-15H,6-7H2,1-5H3/t14?,15?,16-/m0/s1 |
| InChIKey | NVVXVPNPMHHTMX-GPANFISMSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|