About 1-(1,2,4-oxadiazol-3-ylmethyl)-6-oxo-N-propan-2-ylpyridine-3-carboxamide
1-(1,2,4-oxadiazol-3-ylmethyl)-6-oxo-N-propan-2-ylpyridine-3-carboxamide (PubChem CID 59842897) has the molecular formula C12H14N4O3
and a molecular weight of 262.27 g/mol. Its IUPAC name is 1-(1,2,4-oxadiazol-3-ylmethyl)-6-oxo-N-propan-2-ylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | 1-(1,2,4-oxadiazol-3-ylmethyl)-6-oxo-N-propan-2-ylpyridine-3-carboxamide |
| PubChem CID | 59842897 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 1-(1,2,4-oxadiazol-3-ylmethyl)-6-oxo-N-propan-2-ylpyridine-3-carboxamide |
| SMILES | CC(C)NC(=O)c1ccc(=O)n(Cc2ncon2)c1 |
| InChI | InChI=1S/C12H14N4O3/c1-8(2)14-12(18)9-3-4-11(17)16(5-9)6-10-13-7-19-15-10/h3-5,7-8H,6H2,1-2H3,(H,14,18) |
| InChIKey | MIPJMNXRJDWPRQ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(1,2,4-oxadiazol-3-ylmethyl)-6-oxo-N-propan-2-ylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2,4-oxadiazol-3-ylmethyl)-6-oxo-N-propan-2-ylpyridine-3-carboxamide?
The IUPAC name of 1-(1,2,4-oxadiazol-3-ylmethyl)-6-oxo-N-propan-2-ylpyridine-3-carboxamide (CID 59842897) is 1-(1,2,4-oxadiazol-3-ylmethyl)-6-oxo-N-propan-2-ylpyridine-3-carboxamide.
What is the SMILES notation for 1-(1,2,4-oxadiazol-3-ylmethyl)-6-oxo-N-propan-2-ylpyridine-3-carboxamide?
The canonical SMILES for 1-(1,2,4-oxadiazol-3-ylmethyl)-6-oxo-N-propan-2-ylpyridine-3-carboxamide is CC(C)NC(=O)c1ccc(=O)n(Cc2ncon2)c1.
What is the InChIKey of 1-(1,2,4-oxadiazol-3-ylmethyl)-6-oxo-N-propan-2-ylpyridine-3-carboxamide?
The InChIKey is MIPJMNXRJDWPRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O3/c1-8(2)14-12(18)9-3-4-11(17)16(5-9)6-10-13-7-19-15-10/h3-5,7-8H,6H2,1-2H3,(H,14,18).
What are the key properties of 1-(1,2,4-oxadiazol-3-ylmethyl)-6-oxo-N-propan-2-ylpyridine-3-carboxamide?
1-(1,2,4-oxadiazol-3-ylmethyl)-6-oxo-N-propan-2-ylpyridine-3-carboxamide has a molecular weight of 262.27 g/mol, XLogP of 0.42, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2,4-oxadiazol-3-ylmethyl)-6-oxo-N-propan-2-ylpyridine-3-carboxamide is sourced from PubChem (CID 59842897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).