C26H34O6 — CID 59843625
(2S)-3-[(6-hydroxy-4,4,4',4',7,7'-hexamethyl-2,2'-spirobi[3H-chromene]-6'-yl)oxy]propane-1,2-diol (PubChem CID 59843625) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is (2S)-3-[(6-hydroxy-4,4,4',4',7,7'-hexamethyl-2,2'-spirobi[3H-chromene]-6'-yl)oxy]propane-1,2-diol.
| Compound Name | (2S)-3-[(6-hydroxy-4,4,4',4',7,7'-hexamethyl-2,2'-spirobi[3H-chromene]-6'-yl)oxy]propane-1,2-diol |
|---|---|
| PubChem CID | 59843625 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | (2S)-3-[(6-hydroxy-4,4,4',4',7,7'-hexamethyl-2,2'-spirobi[3H-chromene]-6'-yl)oxy]propane-1,2-diol |
| SMILES | Cc1cc2c(cc1O)C(C)(C)CC1(CC(C)(C)c3cc(OC[C@@H](O)CO)c(C)cc3O1)O2 |
| InChI | InChI=1S/C26H34O6/c1-15-7-22-18(9-20(15)29)24(3,4)13-26(31-22)14-25(5,6)19-10-21(30-12-17(28)11-27)16(2)8-23(19)32-26/h7-10,17,27-29H,11-14H2,1-6H3/t17-,26?/m0/s1 |
| InChIKey | ZLWAYLPYOFCQHU-WFFHQLTOSA-N |
| XLogP | 4.26 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |