C13H23NO2 — CID 59843839
5-hydroxy-6,7,7,8,9-pentamethyl-1-azaspiro[3.5]nonan-2-one (PubChem CID 59843839) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 5-hydroxy-6,7,7,8,9-pentamethyl-1-azaspiro[3.5]nonan-2-one.
| Compound Name | 5-hydroxy-6,7,7,8,9-pentamethyl-1-azaspiro[3.5]nonan-2-one |
|---|---|
| PubChem CID | 59843839 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 5-hydroxy-6,7,7,8,9-pentamethyl-1-azaspiro[3.5]nonan-2-one |
| SMILES | CC1C(C)C2(CC(=O)N2)C(O)C(C)C1(C)C |
| InChI | InChI=1S/C13H23NO2/c1-7-8(2)13(6-10(15)14-13)11(16)9(3)12(7,4)5/h7-9,11,16H,6H2,1-5H3,(H,14,15) |
| InChIKey | TUWVJVWTGRRQIV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |