About 6H-cyclopenta[b]pyrazine
6H-cyclopenta[b]pyrazine (PubChem CID 59844085) has the molecular formula C7H6N2
and a molecular weight of 118.14 g/mol. Its IUPAC name is 6H-cyclopenta[b]pyrazine.
Molecular Properties
| Compound Name | 6H-cyclopenta[b]pyrazine |
| PubChem CID | 59844085 |
| Molecular Formula | C7H6N2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | 6H-cyclopenta[b]pyrazine |
| SMILES | C1=c2nccnc2=CC1 |
| InChI | InChI=1S/C7H6N2/c1-2-6-7(3-1)9-5-4-8-6/h2-5H,1H2 |
| InChIKey | QRWVPDVPTAVORS-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6H-cyclopenta[b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-cyclopenta[b]pyrazine?
The IUPAC name of 6H-cyclopenta[b]pyrazine (CID 59844085) is 6H-cyclopenta[b]pyrazine.
What is the SMILES notation for 6H-cyclopenta[b]pyrazine?
The canonical SMILES for 6H-cyclopenta[b]pyrazine is C1=c2nccnc2=CC1.
What is the InChIKey of 6H-cyclopenta[b]pyrazine?
The InChIKey is QRWVPDVPTAVORS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2/c1-2-6-7(3-1)9-5-4-8-6/h2-5H,1H2.
What are the key properties of 6H-cyclopenta[b]pyrazine?
6H-cyclopenta[b]pyrazine has a molecular weight of 118.14 g/mol, XLogP of -0.56, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-cyclopenta[b]pyrazine is sourced from PubChem (CID 59844085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).