C12H19O11- — CID 59844550
(2S)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-3-olate (PubChem CID 59844550) has the molecular formula C12H19O11- and a molecular weight of 339.27 g/mol. Its IUPAC name is (2S)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-3-olate.
| Compound Name | (2S)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-3-olate |
|---|---|
| PubChem CID | 59844550 |
| Molecular Formula | C12H19O11- |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (2S)-2-[(1S)-1,2-dihydroxyethyl]-5-oxo-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-3-olate |
| SMILES | O=C1O[C@H]([C@@H](O)CO)C([O-])C1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H19O11/c13-1-3(15)9-8(19)10(11(20)22-9)23-12-7(18)6(17)5(16)4(2-14)21-12/h3-10,12-18H,1-2H2/q-1/t3-,4+,5+,6-,7+,8?,9+,10?,12+/m0/s1 |
| InChIKey | LUUROIKFIKBVPO-KFTBLGKVSA-N |
| XLogP | -5.82 |
| TPSA | 189.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | -5.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |