C16H26N2O4S — CID 59844659
2-[[(2,2,6,6-tetramethylpiperidin-4-yl)amino]methoxy]benzenesulfonic acid (PubChem CID 59844659) has the molecular formula C16H26N2O4S and a molecular weight of 342.46 g/mol. Its IUPAC name is 2-[[(2,2,6,6-tetramethylpiperidin-4-yl)amino]methoxy]benzenesulfonic acid.
| Compound Name | 2-[[(2,2,6,6-tetramethylpiperidin-4-yl)amino]methoxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 59844659 |
| Molecular Formula | C16H26N2O4S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-[[(2,2,6,6-tetramethylpiperidin-4-yl)amino]methoxy]benzenesulfonic acid |
| SMILES | CC1(C)CC(NCOc2ccccc2S(=O)(=O)O)CC(C)(C)N1 |
| InChI | InChI=1S/C16H26N2O4S/c1-15(2)9-12(10-16(3,4)18-15)17-11-22-13-7-5-6-8-14(13)23(19,20)21/h5-8,12,17-18H,9-11H2,1-4H3,(H,19,20,21) |
| InChIKey | FPTHQAWBEMNXDX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|