C72H48N4Si — CID 59844832
[3,5-di(carbazol-9-yl)-2,6-dideuteriophenyl]-[3,5-di(carbazol-9-yl)-2,4,6-trideuteriophenyl]-diphenylsilane (PubChem CID 59844832) has the molecular formula C72H48N4Si and a molecular weight of 1002.32 g/mol. Its IUPAC name is [3,5-di(carbazol-9-yl)-2,6-dideuteriophenyl]-[3,5-di(carbazol-9-yl)-2,4,6-trideuteriophenyl]-diphenylsilane.
| Compound Name | [3,5-di(carbazol-9-yl)-2,6-dideuteriophenyl]-[3,5-di(carbazol-9-yl)-2,4,6-trideuteriophenyl]-diphenylsilane |
|---|---|
| PubChem CID | 59844832 |
| Molecular Formula | C72H48N4Si |
| Molecular Weight | 1002.32 g/mol |
| Exact Mass | 1001.40 |
| IUPAC Name | [3,5-di(carbazol-9-yl)-2,6-dideuteriophenyl]-[3,5-di(carbazol-9-yl)-2,4,6-trideuteriophenyl]-diphenylsilane |
| SMILES | [2H]c1c(-n2c3ccccc3c3ccccc32)c([2H])c([Si](c2ccccc2)(c2ccccc2)c2c([2H])c(-n3c4ccccc4c4ccccc43)cc(-n3c4ccccc4c4ccccc43)c2[2H])c([2H])c1-n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C72H48N4Si/c1-3-23-53(24-4-1)77(54-25-5-2-6-26-54,55-45-49(73-65-35-15-7-27-57(65)58-28-8-16-36-66(58)73)43-50(46-55)74-67-37-17-9-29-59(67)60-30-10-18-38-68(60)74)56-47-51(75-69-39-19-11-31-61(69)62-32-12-20-40-70(62)75)44-52(48-56)76-71-41-21-13-33-63(71)64-34-14-22-42-72(64)76/h1-48H/i43D,45D,46D,47D,48D |
| InChIKey | FCDNEESKPPIAJZ-KYASRWGOSA-N |
| XLogP | 15.45 |
| TPSA | 19.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1002.32 |
| LogP ≤ 5 | 15.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|