C30H38N6O4 — CID 59845663
tert-butyl N-[4-[[[2-(1,2-diphenylethylamino)-5-nitropyrimidin-4-yl]amino]methyl]cyclohexyl]carbamate (PubChem CID 59845663) has the molecular formula C30H38N6O4 and a molecular weight of 546.67 g/mol. Its IUPAC name is tert-butyl N-[4-[[[2-(1,2-diphenylethylamino)-5-nitropyrimidin-4-yl]amino]methyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[[2-(1,2-diphenylethylamino)-5-nitropyrimidin-4-yl]amino]methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 59845663 |
| Molecular Formula | C30H38N6O4 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | tert-butyl N-[4-[[[2-(1,2-diphenylethylamino)-5-nitropyrimidin-4-yl]amino]methyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CNc2nc(NC(Cc3ccccc3)c3ccccc3)ncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C30H38N6O4/c1-30(2,3)40-29(37)33-24-16-14-22(15-17-24)19-31-27-26(36(38)39)20-32-28(35-27)34-25(23-12-8-5-9-13-23)18-21-10-6-4-7-11-21/h4-13,20,22,24-25H,14-19H2,1-3H3,(H,33,37)(H2,31,32,34,35) |
| InChIKey | MQYTVUPRHGGHTH-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|