C25H29F3N8O4 — CID 59845670
(1S)-2-[[4-[[[5-nitro-2-[[4-(trifluoromethoxy)-3-pyridinyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]amino]-1-pyridin-3-ylethanol (PubChem CID 59845670) has the molecular formula C25H29F3N8O4 and a molecular weight of 562.55 g/mol. Its IUPAC name is (1S)-2-[[4-[[[5-nitro-2-[[4-(trifluoromethoxy)-3-pyridinyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]amino]-1-pyridin-3-ylethanol.
| Compound Name | (1S)-2-[[4-[[[5-nitro-2-[[4-(trifluoromethoxy)-3-pyridinyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]amino]-1-pyridin-3-ylethanol |
|---|---|
| PubChem CID | 59845670 |
| Molecular Formula | C25H29F3N8O4 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | (1S)-2-[[4-[[[5-nitro-2-[[4-(trifluoromethoxy)-3-pyridinyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]amino]-1-pyridin-3-ylethanol |
| SMILES | O=[N+]([O-])c1cnc(NCc2cnccc2OC(F)(F)F)nc1NCC1CCC(NC[C@@H](O)c2cccnc2)CC1 |
| InChI | InChI=1S/C25H29F3N8O4/c26-25(27,28)40-22-7-9-30-12-18(22)13-33-24-34-14-20(36(38)39)23(35-24)32-10-16-3-5-19(6-4-16)31-15-21(37)17-2-1-8-29-11-17/h1-2,7-9,11-12,14,16,19,21,31,37H,3-6,10,13,15H2,(H2,32,33,34,35)/t16?,19?,21-/m1/s1 |
| InChIKey | YULHZBARLJUOOG-VFIGECHUSA-N |
| XLogP | 3.98 |
| TPSA | 160.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|