C26H28F3N7O4 — CID 59845674
2-[[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]amino]-1-pyridin-3-ylethanone (PubChem CID 59845674) has the molecular formula C26H28F3N7O4 and a molecular weight of 559.55 g/mol. Its IUPAC name is 2-[[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]amino]-1-pyridin-3-ylethanone.
| Compound Name | 2-[[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]amino]-1-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 59845674 |
| Molecular Formula | C26H28F3N7O4 |
| Molecular Weight | 559.55 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | 2-[[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]amino]-1-pyridin-3-ylethanone |
| SMILES | O=C(CNC1CCC(CNc2nc(NCc3ccccc3OC(F)(F)F)ncc2[N+](=O)[O-])CC1)c1cccnc1 |
| InChI | InChI=1S/C26H28F3N7O4/c27-26(28,29)40-23-6-2-1-4-19(23)14-33-25-34-15-21(36(38)39)24(35-25)32-12-17-7-9-20(10-8-17)31-16-22(37)18-5-3-11-30-13-18/h1-6,11,13,15,17,20,31H,7-10,12,14,16H2,(H2,32,33,34,35) |
| InChIKey | LMHSNMLHFQVKOX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 144.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|