About N,N,2-trimethyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine
N,N,2-trimethyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine (PubChem CID 59845966) has the molecular formula C8H10N4S
and a molecular weight of 194.26 g/mol. Its IUPAC name is N,N,2-trimethyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine.
Analyze N,N,2-trimethyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,2-trimethyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine?
The IUPAC name of N,N,2-trimethyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine (CID 59845966) is N,N,2-trimethyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine.
What is the SMILES notation for N,N,2-trimethyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine?
The canonical SMILES for N,N,2-trimethyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine is Cc1nc2cnc(N(C)C)nc2s1.
What is the InChIKey of N,N,2-trimethyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine?
The InChIKey is AJTOWHWPHCJVBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4S/c1-5-10-6-4-9-8(12(2)3)11-7(6)13-5/h4H,1-3H3.
What are the key properties of N,N,2-trimethyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine?
N,N,2-trimethyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine has a molecular weight of 194.26 g/mol, XLogP of 1.46, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,2-trimethyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine is sourced from PubChem (CID 59845966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).