About [4-(3,4-dichlorophenyl)piperazin-1-yl]-[(2R)-4-prop-2-enylpiperazin-2-yl]methanone
[4-(3,4-dichlorophenyl)piperazin-1-yl]-[(2R)-4-prop-2-enylpiperazin-2-yl]methanone (PubChem CID 59846080) has the molecular formula C18H24Cl2N4O
and a molecular weight of 383.32 g/mol. Its IUPAC name is [4-(3,4-dichlorophenyl)piperazin-1-yl]-[(2R)-4-prop-2-enylpiperazin-2-yl]methanone.
Molecular Properties
| Compound Name | [4-(3,4-dichlorophenyl)piperazin-1-yl]-[(2R)-4-prop-2-enylpiperazin-2-yl]methanone |
| PubChem CID | 59846080 |
| Molecular Formula | C18H24Cl2N4O |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | [4-(3,4-dichlorophenyl)piperazin-1-yl]-[(2R)-4-prop-2-enylpiperazin-2-yl]methanone |
| SMILES | C=CCN1CCN[C@@H](C(=O)N2CCN(c3ccc(Cl)c(Cl)c3)CC2)C1 |
| InChI | InChI=1S/C18H24Cl2N4O/c1-2-6-22-7-5-21-17(13-22)18(25)24-10-8-23(9-11-24)14-3-4-15(19)16(20)12-14/h2-4,12,17,21H,1,5-11,13H2/t17-/m1/s1 |
| InChIKey | OZWZHMABZSZTAV-QGZVFWFLSA-N |
| XLogP | 2.10 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [4-(3,4-dichlorophenyl)piperazin-1-yl]-[(2R)-4-prop-2-enylpiperazin-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,4-dichlorophenyl)piperazin-1-yl]-[(2R)-4-prop-2-enylpiperazin-2-yl]methanone?
The IUPAC name of [4-(3,4-dichlorophenyl)piperazin-1-yl]-[(2R)-4-prop-2-enylpiperazin-2-yl]methanone (CID 59846080) is [4-(3,4-dichlorophenyl)piperazin-1-yl]-[(2R)-4-prop-2-enylpiperazin-2-yl]methanone.
What is the SMILES notation for [4-(3,4-dichlorophenyl)piperazin-1-yl]-[(2R)-4-prop-2-enylpiperazin-2-yl]methanone?
The canonical SMILES for [4-(3,4-dichlorophenyl)piperazin-1-yl]-[(2R)-4-prop-2-enylpiperazin-2-yl]methanone is C=CCN1CCN[C@@H](C(=O)N2CCN(c3ccc(Cl)c(Cl)c3)CC2)C1.
What is the InChIKey of [4-(3,4-dichlorophenyl)piperazin-1-yl]-[(2R)-4-prop-2-enylpiperazin-2-yl]methanone?
The InChIKey is OZWZHMABZSZTAV-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H24Cl2N4O/c1-2-6-22-7-5-21-17(13-22)18(25)24-10-8-23(9-11-24)14-3-4-15(19)16(20)12-14/h2-4,12,17,21H,1,5-11,13H2/t17-/m1/s1.
What are the key properties of [4-(3,4-dichlorophenyl)piperazin-1-yl]-[(2R)-4-prop-2-enylpiperazin-2-yl]methanone?
[4-(3,4-dichlorophenyl)piperazin-1-yl]-[(2R)-4-prop-2-enylpiperazin-2-yl]methanone has a molecular weight of 383.32 g/mol, XLogP of 2.10, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,4-dichlorophenyl)piperazin-1-yl]-[(2R)-4-prop-2-enylpiperazin-2-yl]methanone is sourced from PubChem (CID 59846080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).