About 3-benzyl-7-chloro-2-(1,3-oxazol-2-yl)-1-phenylquinolin-4-one
3-benzyl-7-chloro-2-(1,3-oxazol-2-yl)-1-phenylquinolin-4-one (PubChem CID 59846231) has the molecular formula C25H17ClN2O2
and a molecular weight of 412.88 g/mol. Its IUPAC name is 3-benzyl-7-chloro-2-(1,3-oxazol-2-yl)-1-phenylquinolin-4-one.
Molecular Properties
| Compound Name | 3-benzyl-7-chloro-2-(1,3-oxazol-2-yl)-1-phenylquinolin-4-one |
| PubChem CID | 59846231 |
| Molecular Formula | C25H17ClN2O2 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 3-benzyl-7-chloro-2-(1,3-oxazol-2-yl)-1-phenylquinolin-4-one |
| SMILES | O=c1c(Cc2ccccc2)c(-c2ncco2)n(-c2ccccc2)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C25H17ClN2O2/c26-18-11-12-20-22(16-18)28(19-9-5-2-6-10-19)23(25-27-13-14-30-25)21(24(20)29)15-17-7-3-1-4-8-17/h1-14,16H,15H2 |
| InChIKey | HZUCPEYBFLDXRC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-benzyl-7-chloro-2-(1,3-oxazol-2-yl)-1-phenylquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-7-chloro-2-(1,3-oxazol-2-yl)-1-phenylquinolin-4-one?
The IUPAC name of 3-benzyl-7-chloro-2-(1,3-oxazol-2-yl)-1-phenylquinolin-4-one (CID 59846231) is 3-benzyl-7-chloro-2-(1,3-oxazol-2-yl)-1-phenylquinolin-4-one.
What is the SMILES notation for 3-benzyl-7-chloro-2-(1,3-oxazol-2-yl)-1-phenylquinolin-4-one?
The canonical SMILES for 3-benzyl-7-chloro-2-(1,3-oxazol-2-yl)-1-phenylquinolin-4-one is O=c1c(Cc2ccccc2)c(-c2ncco2)n(-c2ccccc2)c2cc(Cl)ccc12.
What is the InChIKey of 3-benzyl-7-chloro-2-(1,3-oxazol-2-yl)-1-phenylquinolin-4-one?
The InChIKey is HZUCPEYBFLDXRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H17ClN2O2/c26-18-11-12-20-22(16-18)28(19-9-5-2-6-10-19)23(25-27-13-14-30-25)21(24(20)29)15-17-7-3-1-4-8-17/h1-14,16H,15H2.
What are the key properties of 3-benzyl-7-chloro-2-(1,3-oxazol-2-yl)-1-phenylquinolin-4-one?
3-benzyl-7-chloro-2-(1,3-oxazol-2-yl)-1-phenylquinolin-4-one has a molecular weight of 412.88 g/mol, XLogP of 5.89, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-7-chloro-2-(1,3-oxazol-2-yl)-1-phenylquinolin-4-one is sourced from PubChem (CID 59846231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).