C22H16F2N6O2 — CID 59846348
2-(benzimidazol-1-yl)-9-[(1R,4R)-5,7-difluoro-4-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]-7H-purin-8-one (PubChem CID 59846348) has the molecular formula C22H16F2N6O2 and a molecular weight of 434.41 g/mol. Its IUPAC name is 2-(benzimidazol-1-yl)-9-[(1R,4R)-5,7-difluoro-4-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]-7H-purin-8-one.
| Compound Name | 2-(benzimidazol-1-yl)-9-[(1R,4R)-5,7-difluoro-4-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]-7H-purin-8-one |
|---|---|
| PubChem CID | 59846348 |
| Molecular Formula | C22H16F2N6O2 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 2-(benzimidazol-1-yl)-9-[(1R,4R)-5,7-difluoro-4-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]-7H-purin-8-one |
| SMILES | O=c1[nH]c2cnc(-n3cnc4ccccc43)nc2n1[C@@H]1CC[C@@H](O)c2c(F)cc(F)cc21 |
| InChI | InChI=1S/C22H16F2N6O2/c23-11-7-12-16(5-6-18(31)19(12)13(24)8-11)30-20-15(27-22(30)32)9-25-21(28-20)29-10-26-14-3-1-2-4-17(14)29/h1-4,7-10,16,18,31H,5-6H2,(H,27,32)/t16-,18-/m1/s1 |
| InChIKey | IPCPPUPOUMSAPB-SJLPKXTDSA-N |
| XLogP | 3.15 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |