About magnesium;2-(4-chlorophenyl)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-olate;bromide
magnesium;2-(4-chlorophenyl)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-olate;bromide (PubChem CID 59847105) has the molecular formula C16H22BrClMgO6
and a molecular weight of 450.01 g/mol. Its IUPAC name is magnesium;2-(4-chlorophenyl)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-olate;bromide.
Molecular Properties
| Compound Name | magnesium;2-(4-chlorophenyl)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-olate;bromide |
| PubChem CID | 59847105 |
| Molecular Formula | C16H22BrClMgO6 |
| Molecular Weight | 450.01 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | magnesium;2-(4-chlorophenyl)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-olate;bromide |
| SMILES | COCC1OC([O-])(c2ccc(Cl)cc2)C(OC)C(OC)C1OC.[Br-].[Mg+2] |
| InChI | InChI=1S/C16H22ClO6.BrH.Mg/c1-19-9-12-13(20-2)14(21-3)15(22-4)16(18,23-12)10-5-7-11(17)8-6-10;;/h5-8,12-15H,9H2,1-4H3;1H;/q-1;;+2/p-1 |
| InChIKey | DKBVUPCUEVQRDT-UHFFFAOYSA-M |
| XLogP | -2.43 |
| TPSA | 69.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.01 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze magnesium;2-(4-chlorophenyl)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-olate;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2-(4-chlorophenyl)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-olate;bromide?
The IUPAC name of magnesium;2-(4-chlorophenyl)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-olate;bromide (CID 59847105) is magnesium;2-(4-chlorophenyl)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-olate;bromide.
What is the SMILES notation for magnesium;2-(4-chlorophenyl)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-olate;bromide?
The canonical SMILES for magnesium;2-(4-chlorophenyl)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-olate;bromide is COCC1OC([O-])(c2ccc(Cl)cc2)C(OC)C(OC)C1OC.[Br-].[Mg+2].
What is the InChIKey of magnesium;2-(4-chlorophenyl)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-olate;bromide?
The InChIKey is DKBVUPCUEVQRDT-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H22ClO6.BrH.Mg/c1-19-9-12-13(20-2)14(21-3)15(22-4)16(18,23-12)10-5-7-11(17)8-6-10;;/h5-8,12-15H,9H2,1-4H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;2-(4-chlorophenyl)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-olate;bromide?
magnesium;2-(4-chlorophenyl)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-olate;bromide has a molecular weight of 450.01 g/mol, XLogP of -2.43, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2-(4-chlorophenyl)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-olate;bromide is sourced from PubChem (CID 59847105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).