C30H28N2O6S2 — CID 598472
[3-[5-(dimethylamino)naphthalen-1-yl]sulfonyloxyphenyl] 5-(dimethylamino)naphthalene-1-sulfonate (PubChem CID 598472) has the molecular formula C30H28N2O6S2 and a molecular weight of 576.70 g/mol. Its IUPAC name is [3-[5-(dimethylamino)naphthalen-1-yl]sulfonyloxyphenyl] 5-(dimethylamino)naphthalene-1-sulfonate.
| Compound Name | [3-[5-(dimethylamino)naphthalen-1-yl]sulfonyloxyphenyl] 5-(dimethylamino)naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 598472 |
| Molecular Formula | C30H28N2O6S2 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | [3-[5-(dimethylamino)naphthalen-1-yl]sulfonyloxyphenyl] 5-(dimethylamino)naphthalene-1-sulfonate |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)Oc3cccc(OS(=O)(=O)c4cccc5c(N(C)C)cccc45)c3)cccc12 |
| InChI | InChI=1S/C30H28N2O6S2/c1-31(2)27-16-6-14-25-23(27)12-8-18-29(25)39(33,34)37-21-10-5-11-22(20-21)38-40(35,36)30-19-9-13-24-26(30)15-7-17-28(24)32(3)4/h5-20H,1-4H3 |
| InChIKey | BQWZJCSMMJDHPY-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|