C27H30N8O8S3 — CID 59847221
2-[[6-(butylamino)-5-cyano-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid (PubChem CID 59847221) has the molecular formula C27H30N8O8S3 and a molecular weight of 690.79 g/mol. Its IUPAC name is 2-[[6-(butylamino)-5-cyano-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[6-(butylamino)-5-cyano-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59847221 |
| Molecular Formula | C27H30N8O8S3 |
| Molecular Weight | 690.79 g/mol |
| Exact Mass | 690.13 |
| IUPAC Name | 2-[[6-(butylamino)-5-cyano-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
| SMILES | C=CS(=O)(=O)CCNc1nc(NCCCC)c(C#N)c(C)c1/N=N/c1ccc(/N=N/c2ccc(S(=O)(=O)O)cc2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C27H30N8O8S3/c1-4-6-13-29-26-22(17-28)18(3)25(27(31-26)30-14-15-44(36,37)5-2)35-34-23-12-9-20(16-24(23)46(41,42)43)33-32-19-7-10-21(11-8-19)45(38,39)40/h5,7-12,16H,2,4,6,13-15H2,1,3H3,(H2,29,30,31)(H,38,39,40)(H,41,42,43)/b33-32+,35-34+ |
| InChIKey | QVNKJDWQJIMOFT-VPHDGDOJSA-N |
| XLogP | 5.77 |
| TPSA | 253.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.79 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|