C31H32N8O5S2 — CID 59847224
4-[[4-[[6-(butylamino)-5-cyano-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]naphthalen-1-yl]diazenyl]benzenesulfonic acid (PubChem CID 59847224) has the molecular formula C31H32N8O5S2 and a molecular weight of 660.78 g/mol. Its IUPAC name is 4-[[4-[[6-(butylamino)-5-cyano-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]naphthalen-1-yl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-[[4-[[6-(butylamino)-5-cyano-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]naphthalen-1-yl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59847224 |
| Molecular Formula | C31H32N8O5S2 |
| Molecular Weight | 660.78 g/mol |
| Exact Mass | 660.19 |
| IUPAC Name | 4-[[4-[[6-(butylamino)-5-cyano-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]naphthalen-1-yl]diazenyl]benzenesulfonic acid |
| SMILES | C=CS(=O)(=O)CCNc1nc(NCCCC)c(C#N)c(C)c1/N=N/c1ccc(/N=N/c2ccc(S(=O)(=O)O)cc2)c2ccccc12 |
| InChI | InChI=1S/C31H32N8O5S2/c1-4-6-17-33-30-26(20-32)21(3)29(31(35-30)34-18-19-45(40,41)5-2)39-38-28-16-15-27(24-9-7-8-10-25(24)28)37-36-22-11-13-23(14-12-22)46(42,43)44/h5,7-16H,2,4,6,17-19H2,1,3H3,(H2,33,34,35)(H,42,43,44)/b37-36+,39-38+ |
| InChIKey | UGEGZWUWUUWNLQ-DVQJGIKISA-N |
| XLogP | 7.67 |
| TPSA | 198.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.78 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|