C29H32N8O8S3 — CID 59847226
2-[[5-cyano-6-(cyclohexylamino)-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid (PubChem CID 59847226) has the molecular formula C29H32N8O8S3 and a molecular weight of 716.82 g/mol. Its IUPAC name is 2-[[5-cyano-6-(cyclohexylamino)-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[5-cyano-6-(cyclohexylamino)-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59847226 |
| Molecular Formula | C29H32N8O8S3 |
| Molecular Weight | 716.82 g/mol |
| Exact Mass | 716.15 |
| IUPAC Name | 2-[[5-cyano-6-(cyclohexylamino)-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
| SMILES | C=CS(=O)(=O)CCNc1nc(NC2CCCCC2)c(C#N)c(C)c1/N=N/c1ccc(/N=N/c2ccc(S(=O)(=O)O)cc2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C29H32N8O8S3/c1-3-46(38,39)16-15-31-29-27(19(2)24(18-30)28(33-29)32-20-7-5-4-6-8-20)37-36-25-14-11-22(17-26(25)48(43,44)45)35-34-21-9-12-23(13-10-21)47(40,41)42/h3,9-14,17,20H,1,4-8,15-16H2,2H3,(H2,31,32,33)(H,40,41,42)(H,43,44,45)/b35-34+,37-36+ |
| InChIKey | DYHWBOREROUIIH-XGMUGIETSA-N |
| XLogP | 6.30 |
| TPSA | 253.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.82 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|