C31H32N8O6S2 — CID 59847241
4-[[4-[[5-cyano-2-(2-ethenylsulfonylethylamino)-6-(3-methoxypropylamino)-4-methyl-3-pyridinyl]diazenyl]naphthalen-1-yl]diazenyl]benzenesulfonic acid (PubChem CID 59847241) has the molecular formula C31H32N8O6S2 and a molecular weight of 676.78 g/mol. Its IUPAC name is 4-[[4-[[5-cyano-2-(2-ethenylsulfonylethylamino)-6-(3-methoxypropylamino)-4-methyl-3-pyridinyl]diazenyl]naphthalen-1-yl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-[[4-[[5-cyano-2-(2-ethenylsulfonylethylamino)-6-(3-methoxypropylamino)-4-methyl-3-pyridinyl]diazenyl]naphthalen-1-yl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59847241 |
| Molecular Formula | C31H32N8O6S2 |
| Molecular Weight | 676.78 g/mol |
| Exact Mass | 676.19 |
| IUPAC Name | 4-[[4-[[5-cyano-2-(2-ethenylsulfonylethylamino)-6-(3-methoxypropylamino)-4-methyl-3-pyridinyl]diazenyl]naphthalen-1-yl]diazenyl]benzenesulfonic acid |
| SMILES | C=CS(=O)(=O)CCNc1nc(NCCCOC)c(C#N)c(C)c1/N=N/c1ccc(/N=N/c2ccc(S(=O)(=O)O)cc2)c2ccccc12 |
| InChI | InChI=1S/C31H32N8O6S2/c1-4-46(40,41)19-17-34-31-29(21(2)26(20-32)30(35-31)33-16-7-18-45-3)39-38-28-15-14-27(24-8-5-6-9-25(24)28)37-36-22-10-12-23(13-11-22)47(42,43)44/h4-6,8-15H,1,7,16-19H2,2-3H3,(H2,33,34,35)(H,42,43,44)/b37-36+,39-38+ |
| InChIKey | ADWJOTIWURKVDN-DVQJGIKISA-N |
| XLogP | 6.91 |
| TPSA | 207.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.78 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|