C23H26N6O19S6 — CID 59847247
7-[[5-cyano-4-methyl-2-(2-sulfooxyethylamino)-6-[2-(2-sulfooxyethylsulfonyl)ethylamino]-3-pyridinyl]diazenyl]naphthalene-1,3,6-trisulfonic acid (PubChem CID 59847247) has the molecular formula C23H26N6O19S6 and a molecular weight of 882.89 g/mol. Its IUPAC name is 7-[[5-cyano-4-methyl-2-(2-sulfooxyethylamino)-6-[2-(2-sulfooxyethylsulfonyl)ethylamino]-3-pyridinyl]diazenyl]naphthalene-1,3,6-trisulfonic acid.
| Compound Name | 7-[[5-cyano-4-methyl-2-(2-sulfooxyethylamino)-6-[2-(2-sulfooxyethylsulfonyl)ethylamino]-3-pyridinyl]diazenyl]naphthalene-1,3,6-trisulfonic acid |
|---|---|
| PubChem CID | 59847247 |
| Molecular Formula | C23H26N6O19S6 |
| Molecular Weight | 882.89 g/mol |
| Exact Mass | 881.96 |
| IUPAC Name | 7-[[5-cyano-4-methyl-2-(2-sulfooxyethylamino)-6-[2-(2-sulfooxyethylsulfonyl)ethylamino]-3-pyridinyl]diazenyl]naphthalene-1,3,6-trisulfonic acid |
| SMILES | Cc1c(C#N)c(NCCS(=O)(=O)CCOS(=O)(=O)O)nc(NCCOS(=O)(=O)O)c1/N=N/c1cc2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc2cc1S(=O)(=O)O |
| InChI | InChI=1S/C23H26N6O19S6/c1-13-17(12-24)22(26-3-6-49(30,31)7-5-48-54(44,45)46)27-23(25-2-4-47-53(41,42)43)21(13)29-28-18-11-16-14(9-20(18)52(38,39)40)8-15(50(32,33)34)10-19(16)51(35,36)37/h8-11H,2-7H2,1H3,(H2,25,26,27)(H,32,33,34)(H,35,36,37)(H,38,39,40)(H,41,42,43)(H,44,45,46)/b29-28+ |
| InChIKey | BRCSZOVRZZYGDO-ZQHSETAFSA-N |
| XLogP | 0.45 |
| TPSA | 409.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.89 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|