C31H30N8O12S4 — CID 59847258
2-[[5-cyano-2-[2-(4-ethenylsulfonylphenyl)ethylamino]-4-methyl-6-(2-sulfooxyethylamino)-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid (PubChem CID 59847258) has the molecular formula C31H30N8O12S4 and a molecular weight of 834.89 g/mol. Its IUPAC name is 2-[[5-cyano-2-[2-(4-ethenylsulfonylphenyl)ethylamino]-4-methyl-6-(2-sulfooxyethylamino)-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[5-cyano-2-[2-(4-ethenylsulfonylphenyl)ethylamino]-4-methyl-6-(2-sulfooxyethylamino)-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59847258 |
| Molecular Formula | C31H30N8O12S4 |
| Molecular Weight | 834.89 g/mol |
| Exact Mass | 834.09 |
| IUPAC Name | 2-[[5-cyano-2-[2-(4-ethenylsulfonylphenyl)ethylamino]-4-methyl-6-(2-sulfooxyethylamino)-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
| SMILES | C=CS(=O)(=O)c1ccc(CCNc2nc(NCCOS(=O)(=O)O)c(C#N)c(C)c2/N=N/c2ccc(/N=N/c3ccc(S(=O)(=O)O)cc3)cc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C31H30N8O12S4/c1-3-52(40,41)24-9-4-21(5-10-24)14-15-33-31-29(20(2)26(19-32)30(35-31)34-16-17-51-55(48,49)50)39-38-27-13-8-23(18-28(27)54(45,46)47)37-36-22-6-11-25(12-7-22)53(42,43)44/h3-13,18H,1,14-17H2,2H3,(H2,33,34,35)(H,42,43,44)(H,45,46,47)(H,48,49,50)/b37-36+,39-38+ |
| InChIKey | UTGJYRWOOKHSFN-DVQJGIKISA-N |
| XLogP | 5.39 |
| TPSA | 316.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.89 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|