C27H28N8O10S4 — CID 59847273
2-[[5-cyano-2,6-bis(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid (PubChem CID 59847273) has the molecular formula C27H28N8O10S4 and a molecular weight of 752.83 g/mol. Its IUPAC name is 2-[[5-cyano-2,6-bis(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[5-cyano-2,6-bis(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59847273 |
| Molecular Formula | C27H28N8O10S4 |
| Molecular Weight | 752.83 g/mol |
| Exact Mass | 752.08 |
| IUPAC Name | 2-[[5-cyano-2,6-bis(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
| SMILES | C=CS(=O)(=O)CCNc1nc(NCCS(=O)(=O)C=C)c(/N=N/c2ccc(/N=N/c3ccc(S(=O)(=O)O)cc3)cc2S(=O)(=O)O)c(C)c1C#N |
| InChI | InChI=1S/C27H28N8O10S4/c1-4-46(36,37)14-12-29-26-22(17-28)18(3)25(27(31-26)30-13-15-47(38,39)5-2)35-34-23-11-8-20(16-24(23)49(43,44)45)33-32-19-6-9-21(10-7-19)48(40,41)42/h4-11,16H,1-2,12-15H2,3H3,(H2,29,30,31)(H,40,41,42)(H,43,44,45)/b33-32+,35-34+ |
| InChIKey | MVAZYHUGPLVUBD-VPHDGDOJSA-N |
| XLogP | 4.53 |
| TPSA | 287.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.83 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|