C28H56N8O4 — CID 59847627
N'-[(3S,4R)-3,4-diaminocyclohexyl]-N-[5-[[(3Z)-3-hydroxyimino-2-methylbutan-2-yl]amino]-3-[2-[[(3Z)-3-hydroxyimino-2-methylbutan-2-yl]amino]ethyl]pentyl]pentanediamide (PubChem CID 59847627) has the molecular formula C28H56N8O4 and a molecular weight of 568.81 g/mol. Its IUPAC name is N'-[(3S,4R)-3,4-diaminocyclohexyl]-N-[5-[[(3Z)-3-hydroxyimino-2-methylbutan-2-yl]amino]-3-[2-[[(3Z)-3-hydroxyimino-2-methylbutan-2-yl]amino]ethyl]pentyl]pentanediamide.
| Compound Name | N'-[(3S,4R)-3,4-diaminocyclohexyl]-N-[5-[[(3Z)-3-hydroxyimino-2-methylbutan-2-yl]amino]-3-[2-[[(3Z)-3-hydroxyimino-2-methylbutan-2-yl]amino]ethyl]pentyl]pentanediamide |
|---|---|
| PubChem CID | 59847627 |
| Molecular Formula | C28H56N8O4 |
| Molecular Weight | 568.81 g/mol |
| Exact Mass | 568.44 |
| IUPAC Name | N'-[(3S,4R)-3,4-diaminocyclohexyl]-N-[5-[[(3Z)-3-hydroxyimino-2-methylbutan-2-yl]amino]-3-[2-[[(3Z)-3-hydroxyimino-2-methylbutan-2-yl]amino]ethyl]pentyl]pentanediamide |
| SMILES | C/C(=N/O)C(C)(C)NCCC(CCNC(=O)CCCC(=O)NC1CC[C@@H](N)[C@@H](N)C1)CCNC(C)(C)/C(C)=N\O |
| InChI | InChI=1S/C28H56N8O4/c1-19(35-39)27(3,4)32-16-13-21(14-17-33-28(5,6)20(2)36-40)12-15-31-25(37)8-7-9-26(38)34-22-10-11-23(29)24(30)18-22/h21-24,32-33,39-40H,7-18,29-30H2,1-6H3,(H,31,37)(H,34,38)/b35-19-,36-20-/t22?,23-,24+/m1/s1 |
| InChIKey | YEURJLGXAQLEGG-UTHQJALQSA-N |
| XLogP | 1.82 |
| TPSA | 199.48 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.81 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|