C13H26N2 — CID 59848272
N-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-yl)ethyl]propan-2-amine (PubChem CID 59848272) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is N-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-yl)ethyl]propan-2-amine.
| Compound Name | N-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-yl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 59848272 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | N-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-yl)ethyl]propan-2-amine |
| SMILES | CC(C)NCCC1CNC2CCCCC12 |
| InChI | InChI=1S/C13H26N2/c1-10(2)14-8-7-11-9-15-13-6-4-3-5-12(11)13/h10-15H,3-9H2,1-2H3 |
| InChIKey | UGNHQERAYGCBIM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |