About 2-tert-butyl-5-(2,2-dimethylpropyl)-4-methyloxolan-3-amine
2-tert-butyl-5-(2,2-dimethylpropyl)-4-methyloxolan-3-amine (PubChem CID 59848423) has the molecular formula C14H29NO
and a molecular weight of 227.39 g/mol. Its IUPAC name is 2-tert-butyl-5-(2,2-dimethylpropyl)-4-methyloxolan-3-amine.
Molecular Properties
| Compound Name | 2-tert-butyl-5-(2,2-dimethylpropyl)-4-methyloxolan-3-amine |
| PubChem CID | 59848423 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 2-tert-butyl-5-(2,2-dimethylpropyl)-4-methyloxolan-3-amine |
| SMILES | CC1C(CC(C)(C)C)OC(C(C)(C)C)C1N |
| InChI | InChI=1S/C14H29NO/c1-9-10(8-13(2,3)4)16-12(11(9)15)14(5,6)7/h9-12H,8,15H2,1-7H3 |
| InChIKey | VCYMODOBJWEDQO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-5-(2,2-dimethylpropyl)-4-methyloxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-(2,2-dimethylpropyl)-4-methyloxolan-3-amine?
The IUPAC name of 2-tert-butyl-5-(2,2-dimethylpropyl)-4-methyloxolan-3-amine (CID 59848423) is 2-tert-butyl-5-(2,2-dimethylpropyl)-4-methyloxolan-3-amine.
What is the SMILES notation for 2-tert-butyl-5-(2,2-dimethylpropyl)-4-methyloxolan-3-amine?
The canonical SMILES for 2-tert-butyl-5-(2,2-dimethylpropyl)-4-methyloxolan-3-amine is CC1C(CC(C)(C)C)OC(C(C)(C)C)C1N.
What is the InChIKey of 2-tert-butyl-5-(2,2-dimethylpropyl)-4-methyloxolan-3-amine?
The InChIKey is VCYMODOBJWEDQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO/c1-9-10(8-13(2,3)4)16-12(11(9)15)14(5,6)7/h9-12H,8,15H2,1-7H3.
What are the key properties of 2-tert-butyl-5-(2,2-dimethylpropyl)-4-methyloxolan-3-amine?
2-tert-butyl-5-(2,2-dimethylpropyl)-4-methyloxolan-3-amine has a molecular weight of 227.39 g/mol, XLogP of 3.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-(2,2-dimethylpropyl)-4-methyloxolan-3-amine is sourced from PubChem (CID 59848423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).