C23H28FN5O5S — CID 59848824
propan-2-yl 4-[4-(2-fluoro-4-methylperoxysulfanylanilino)-7-oxo-5,6-dihydropyrido[2,3-d]pyrimidin-8-yl]piperidine-1-carboxylate (PubChem CID 59848824) has the molecular formula C23H28FN5O5S and a molecular weight of 505.57 g/mol. Its IUPAC name is propan-2-yl 4-[4-(2-fluoro-4-methylperoxysulfanylanilino)-7-oxo-5,6-dihydropyrido[2,3-d]pyrimidin-8-yl]piperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[4-(2-fluoro-4-methylperoxysulfanylanilino)-7-oxo-5,6-dihydropyrido[2,3-d]pyrimidin-8-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59848824 |
| Molecular Formula | C23H28FN5O5S |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | propan-2-yl 4-[4-(2-fluoro-4-methylperoxysulfanylanilino)-7-oxo-5,6-dihydropyrido[2,3-d]pyrimidin-8-yl]piperidine-1-carboxylate |
| SMILES | COOSc1ccc(Nc2ncnc3c2CCC(=O)N3C2CCN(C(=O)OC(C)C)CC2)c(F)c1 |
| InChI | InChI=1S/C23H28FN5O5S/c1-14(2)33-23(31)28-10-8-15(9-11-28)29-20(30)7-5-17-21(25-13-26-22(17)29)27-19-6-4-16(12-18(19)24)35-34-32-3/h4,6,12-15H,5,7-11H2,1-3H3,(H,25,26,27) |
| InChIKey | ZODSRNYGMRCAQN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|