C11H14N2O — CID 59848827
1,3-dimethyl-4,5-dihydro-3H-1,4-benzodiazepin-2-one (PubChem CID 59848827) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 1,3-dimethyl-4,5-dihydro-3H-1,4-benzodiazepin-2-one.
| Compound Name | 1,3-dimethyl-4,5-dihydro-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 59848827 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1,3-dimethyl-4,5-dihydro-3H-1,4-benzodiazepin-2-one |
| SMILES | CC1NCc2ccccc2N(C)C1=O |
| InChI | InChI=1S/C11H14N2O/c1-8-11(14)13(2)10-6-4-3-5-9(10)7-12-8/h3-6,8,12H,7H2,1-2H3 |
| InChIKey | IFUDBYHTZQLQGN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |