C9H12N2O2 — CID 59848916
4-(hydroxymethyl)-N,N-dimethylpyridine-2-carboxamide (PubChem CID 59848916) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 4-(hydroxymethyl)-N,N-dimethylpyridine-2-carboxamide.
| Compound Name | 4-(hydroxymethyl)-N,N-dimethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 59848916 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 4-(hydroxymethyl)-N,N-dimethylpyridine-2-carboxamide |
| SMILES | CN(C)C(=O)c1cc(CO)ccn1 |
| InChI | InChI=1S/C9H12N2O2/c1-11(2)9(13)8-5-7(6-12)3-4-10-8/h3-5,12H,6H2,1-2H3 |
| InChIKey | OCLLSOCUPUYHED-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |