C9H8F3NO2 — CID 59848973
2,2,3-trifluoro-7-methyl-3H-1,4-benzodioxin-6-amine (PubChem CID 59848973) has the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. Its IUPAC name is 2,2,3-trifluoro-7-methyl-3H-1,4-benzodioxin-6-amine.
| Compound Name | 2,2,3-trifluoro-7-methyl-3H-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 59848973 |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.16 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 2,2,3-trifluoro-7-methyl-3H-1,4-benzodioxin-6-amine |
| SMILES | Cc1cc2c(cc1N)OC(F)C(F)(F)O2 |
| InChI | InChI=1S/C9H8F3NO2/c1-4-2-7-6(3-5(4)13)14-8(10)9(11,12)15-7/h2-3,8H,13H2,1H3 |
| InChIKey | BHJXWQUYMBMQHZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.16 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|