C32H32N6O — CID 59849299
4-[[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-N-methyl-N'-phenylbenzohydrazide (PubChem CID 59849299) has the molecular formula C32H32N6O and a molecular weight of 516.65 g/mol. Its IUPAC name is 4-[[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-N-methyl-N'-phenylbenzohydrazide.
| Compound Name | 4-[[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-N-methyl-N'-phenylbenzohydrazide |
|---|---|
| PubChem CID | 59849299 |
| Molecular Formula | C32H32N6O |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | 4-[[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-N-methyl-N'-phenylbenzohydrazide |
| SMILES | CN(Nc1ccccc1)C(=O)c1ccc(CN(Cc2nc3ccccc3[nH]2)C2CCCc3cccnc32)cc1 |
| InChI | InChI=1S/C32H32N6O/c1-37(36-26-11-3-2-4-12-26)32(39)25-18-16-23(17-19-25)21-38(22-30-34-27-13-5-6-14-28(27)35-30)29-15-7-9-24-10-8-20-33-31(24)29/h2-6,8,10-14,16-20,29,36H,7,9,15,21-22H2,1H3,(H,34,35) |
| InChIKey | MRGMOTLYYQHOJQ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|