C31H30N6O — CID 59849317
4-[[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-N'-phenylbenzohydrazide (PubChem CID 59849317) has the molecular formula C31H30N6O and a molecular weight of 502.62 g/mol. Its IUPAC name is 4-[[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-N'-phenylbenzohydrazide.
| Compound Name | 4-[[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-N'-phenylbenzohydrazide |
|---|---|
| PubChem CID | 59849317 |
| Molecular Formula | C31H30N6O |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | 4-[[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-N'-phenylbenzohydrazide |
| SMILES | O=C(NNc1ccccc1)c1ccc(CN(Cc2nc3ccccc3[nH]2)C2CCCc3cccnc32)cc1 |
| InChI | InChI=1S/C31H30N6O/c38-31(36-35-25-10-2-1-3-11-25)24-17-15-22(16-18-24)20-37(21-29-33-26-12-4-5-13-27(26)34-29)28-14-6-8-23-9-7-19-32-30(23)28/h1-5,7,9-13,15-19,28,35H,6,8,14,20-21H2,(H,33,34)(H,36,38) |
| InChIKey | GQPCDZJEDUURSJ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|