About 6-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]-1H-quinolin-2-one
6-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]-1H-quinolin-2-one (PubChem CID 59849705) has the molecular formula C20H13F2N3O2
and a molecular weight of 365.34 g/mol. Its IUPAC name is 6-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 6-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]-1H-quinolin-2-one |
| PubChem CID | 59849705 |
| Molecular Formula | C20H13F2N3O2 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 6-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]-1H-quinolin-2-one |
| SMILES | O=c1ccc2cc(Cn3nc(-c4cc(F)cc(F)c4)ccc3=O)ccc2[nH]1 |
| InChI | InChI=1S/C20H13F2N3O2/c21-15-8-14(9-16(22)10-15)18-4-6-20(27)25(24-18)11-12-1-3-17-13(7-12)2-5-19(26)23-17/h1-10H,11H2,(H,23,26) |
| InChIKey | CNZOWGNFFCOMPF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]-1H-quinolin-2-one?
The IUPAC name of 6-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]-1H-quinolin-2-one (CID 59849705) is 6-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]-1H-quinolin-2-one.
What is the SMILES notation for 6-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]-1H-quinolin-2-one?
The canonical SMILES for 6-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]-1H-quinolin-2-one is O=c1ccc2cc(Cn3nc(-c4cc(F)cc(F)c4)ccc3=O)ccc2[nH]1.
What is the InChIKey of 6-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]-1H-quinolin-2-one?
The InChIKey is CNZOWGNFFCOMPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13F2N3O2/c21-15-8-14(9-16(22)10-15)18-4-6-20(27)25(24-18)11-12-1-3-17-13(7-12)2-5-19(26)23-17/h1-10H,11H2,(H,23,26).
What are the key properties of 6-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]-1H-quinolin-2-one?
6-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]-1H-quinolin-2-one has a molecular weight of 365.34 g/mol, XLogP of 3.08, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]-1H-quinolin-2-one is sourced from PubChem (CID 59849705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).