C30H31N9O3S2Y2-2 — CID 59850043
N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-4-[5-(2,4,6-trimethylbenzene-3,5-diid-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperazine-1-carboxamide;bis(yttrium) (PubChem CID 59850043) has the molecular formula C30H31N9O3S2Y2-2 and a molecular weight of 807.58 g/mol. Its IUPAC name is N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-4-[5-(2,4,6-trimethylbenzene-3,5-diid-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperazine-1-carboxamide;bis(yttrium).
| Compound Name | N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-4-[5-(2,4,6-trimethylbenzene-3,5-diid-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperazine-1-carboxamide;bis(yttrium) |
|---|---|
| PubChem CID | 59850043 |
| Molecular Formula | C30H31N9O3S2Y2-2 |
| Molecular Weight | 807.58 g/mol |
| Exact Mass | 807.01 |
| IUPAC Name | N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-4-[5-(2,4,6-trimethylbenzene-3,5-diid-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperazine-1-carboxamide;bis(yttrium) |
| SMILES | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)N3CCN(c4ncnc5[nH]cc(-c6c(C)[c-]c(C)[c-]c6C)c45)CC3)cc2)s1.[Y].[Y] |
| InChI | InChI=1S/C30H31N9O3S2.2Y/c1-5-24-35-36-29(43-24)37-44(41,42)22-8-6-21(7-9-22)34-30(40)39-12-10-38(11-13-39)28-26-23(16-31-27(26)32-17-33-28)25-19(3)14-18(2)15-20(25)4;;/h6-9,16-17H,5,10-13H2,1-4H3,(H,34,40)(H,36,37)(H,31,32,33);;/q-2;; |
| InChIKey | GRWJUYATUFHODO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 149.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|