C24H40O6 — CID 59850088
(1S,3S,7S,10R,11S,12S,16R)-3-[(E)-but-2-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 59850088) has the molecular formula C24H40O6 and a molecular weight of 424.58 g/mol. Its IUPAC name is (1S,3S,7S,10R,11S,12S,16R)-3-[(E)-but-2-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,7S,10R,11S,12S,16R)-3-[(E)-but-2-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 59850088 |
| Molecular Formula | C24H40O6 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | (1S,3S,7S,10R,11S,12S,16R)-3-[(E)-but-2-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C/C=C(\C)[C@@H]1C[C@@H]2O[C@]2(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C24H40O6/c1-8-14(2)17-12-19-24(7,30-19)11-9-10-15(3)21(27)16(4)22(28)23(5,6)18(25)13-20(26)29-17/h8,15-19,21,25,27H,9-13H2,1-7H3/b14-8+/t15-,16+,17-,18-,19-,21-,24+/m0/s1 |
| InChIKey | LIMDPEZJGDUBNW-HZVIOZMOSA-N |
| XLogP | 3.58 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|