C18H21N3O6S2 — CID 59850298
1-[2-[[3-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]methyl]phenyl]-N,N-dimethylmethanesulfonamide (PubChem CID 59850298) has the molecular formula C18H21N3O6S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 1-[2-[[3-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]methyl]phenyl]-N,N-dimethylmethanesulfonamide.
| Compound Name | 1-[2-[[3-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]methyl]phenyl]-N,N-dimethylmethanesulfonamide |
|---|---|
| PubChem CID | 59850298 |
| Molecular Formula | C18H21N3O6S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 1-[2-[[3-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]methyl]phenyl]-N,N-dimethylmethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)Cc1ccccc1Cc1ccc(N2CC(=O)NS2(=O)=O)c(O)c1 |
| InChI | InChI=1S/C18H21N3O6S2/c1-20(2)28(24,25)12-15-6-4-3-5-14(15)9-13-7-8-16(17(22)10-13)21-11-18(23)19-29(21,26)27/h3-8,10,22H,9,11-12H2,1-2H3,(H,19,23) |
| InChIKey | FZTQKLVYJOHKCY-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |