C12H26S — CID 59850429
2,3,4,6,6-pentamethylheptane-3-thiol (PubChem CID 59850429) has the molecular formula C12H26S and a molecular weight of 202.41 g/mol. Its IUPAC name is 2,3,4,6,6-pentamethylheptane-3-thiol.
| Compound Name | 2,3,4,6,6-pentamethylheptane-3-thiol |
|---|---|
| PubChem CID | 59850429 |
| Molecular Formula | C12H26S |
| Molecular Weight | 202.41 g/mol |
| Exact Mass | 202.18 |
| IUPAC Name | 2,3,4,6,6-pentamethylheptane-3-thiol |
| SMILES | CC(C)C(C)(S)C(C)CC(C)(C)C |
| InChI | InChI=1S/C12H26S/c1-9(2)12(7,13)10(3)8-11(4,5)6/h9-10,13H,8H2,1-7H3 |
| InChIKey | QRIRIKYIOIYVCE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|