About spiro[7-oxabicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one
spiro[7-oxabicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one (PubChem CID 59850797) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is spiro[7-oxabicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one.
Molecular Properties
| Compound Name | spiro[7-oxabicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one |
| PubChem CID | 59850797 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | spiro[7-oxabicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one |
| SMILES | O=C1CC2(CO1)CC1CCC2O1 |
| InChI | InChI=1S/C9H12O3/c10-8-4-9(5-11-8)3-6-1-2-7(9)12-6/h6-7H,1-5H2 |
| InChIKey | IFGBUGVNLKJFIJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[7-oxabicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[7-oxabicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one?
The IUPAC name of spiro[7-oxabicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one (CID 59850797) is spiro[7-oxabicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one.
What is the SMILES notation for spiro[7-oxabicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one?
The canonical SMILES for spiro[7-oxabicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one is O=C1CC2(CO1)CC1CCC2O1.
What is the InChIKey of spiro[7-oxabicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one?
The InChIKey is IFGBUGVNLKJFIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c10-8-4-9(5-11-8)3-6-1-2-7(9)12-6/h6-7H,1-5H2.
What are the key properties of spiro[7-oxabicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one?
spiro[7-oxabicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one has a molecular weight of 168.19 g/mol, XLogP of 0.87, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[7-oxabicyclo[2.2.1]heptane-2,4'-oxolane]-2'-one is sourced from PubChem (CID 59850797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).