About [2,6-dimethyl-4-(phosphanylmethyl)phenyl] 10-butylacridin-10-ium-9-carboxylate
[2,6-dimethyl-4-(phosphanylmethyl)phenyl] 10-butylacridin-10-ium-9-carboxylate (PubChem CID 59850885) has the molecular formula C27H29NO2P+
and a molecular weight of 430.51 g/mol. Its IUPAC name is [2,6-dimethyl-4-(phosphanylmethyl)phenyl] 10-butylacridin-10-ium-9-carboxylate.
Molecular Properties
| Compound Name | [2,6-dimethyl-4-(phosphanylmethyl)phenyl] 10-butylacridin-10-ium-9-carboxylate |
| PubChem CID | 59850885 |
| Molecular Formula | C27H29NO2P+ |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | [2,6-dimethyl-4-(phosphanylmethyl)phenyl] 10-butylacridin-10-ium-9-carboxylate |
| SMILES | CCCC[n+]1c2ccccc2c(C(=O)Oc2c(C)cc(CP)cc2C)c2ccccc21 |
| InChI | InChI=1S/C27H29NO2P/c1-4-5-14-28-23-12-8-6-10-21(23)25(22-11-7-9-13-24(22)28)27(29)30-26-18(2)15-20(17-31)16-19(26)3/h6-13,15-16H,4-5,14,17,31H2,1-3H3/q+1 |
| InChIKey | MGFSAWSTGWMKII-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [2,6-dimethyl-4-(phosphanylmethyl)phenyl] 10-butylacridin-10-ium-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-dimethyl-4-(phosphanylmethyl)phenyl] 10-butylacridin-10-ium-9-carboxylate?
The IUPAC name of [2,6-dimethyl-4-(phosphanylmethyl)phenyl] 10-butylacridin-10-ium-9-carboxylate (CID 59850885) is [2,6-dimethyl-4-(phosphanylmethyl)phenyl] 10-butylacridin-10-ium-9-carboxylate.
What is the SMILES notation for [2,6-dimethyl-4-(phosphanylmethyl)phenyl] 10-butylacridin-10-ium-9-carboxylate?
The canonical SMILES for [2,6-dimethyl-4-(phosphanylmethyl)phenyl] 10-butylacridin-10-ium-9-carboxylate is CCCC[n+]1c2ccccc2c(C(=O)Oc2c(C)cc(CP)cc2C)c2ccccc21.
What is the InChIKey of [2,6-dimethyl-4-(phosphanylmethyl)phenyl] 10-butylacridin-10-ium-9-carboxylate?
The InChIKey is MGFSAWSTGWMKII-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29NO2P/c1-4-5-14-28-23-12-8-6-10-21(23)25(22-11-7-9-13-24(22)28)27(29)30-26-18(2)15-20(17-31)16-19(26)3/h6-13,15-16H,4-5,14,17,31H2,1-3H3/q+1.
What are the key properties of [2,6-dimethyl-4-(phosphanylmethyl)phenyl] 10-butylacridin-10-ium-9-carboxylate?
[2,6-dimethyl-4-(phosphanylmethyl)phenyl] 10-butylacridin-10-ium-9-carboxylate has a molecular weight of 430.51 g/mol, XLogP of 6.29, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-dimethyl-4-(phosphanylmethyl)phenyl] 10-butylacridin-10-ium-9-carboxylate is sourced from PubChem (CID 59850885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).